C14H20BrCl2NO2 — CID 68943656
4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;hydrobromide (PubChem CID 68943656) has the molecular formula C14H20BrCl2NO2 and a molecular weight of 385.13 g/mol. Its IUPAC name is 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;hydrobromide.
| Compound Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;hydrobromide |
|---|---|
| PubChem CID | 68943656 |
| Molecular Formula | C14H20BrCl2NO2 |
| Molecular Weight | 385.13 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;hydrobromide |
| SMILES | Br.O=C(O)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C14H19Cl2NO2.BrH/c15-8-10-17(11-9-16)13-6-4-12(5-7-13)2-1-3-14(18)19;/h4-7H,1-3,8-11H2,(H,18,19);1H |
| InChIKey | AIJXQRQZUQBTNH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|