C16H26Cl2N2 — CID 14650304
4-(6-aminohexyl)-N,N-bis(2-chloroethyl)aniline (PubChem CID 14650304) has the molecular formula C16H26Cl2N2 and a molecular weight of 317.30 g/mol. Its IUPAC name is 4-(6-aminohexyl)-N,N-bis(2-chloroethyl)aniline.
| Compound Name | 4-(6-aminohexyl)-N,N-bis(2-chloroethyl)aniline |
|---|---|
| PubChem CID | 14650304 |
| Molecular Formula | C16H26Cl2N2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-(6-aminohexyl)-N,N-bis(2-chloroethyl)aniline |
| SMILES | NCCCCCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C16H26Cl2N2/c17-10-13-20(14-11-18)16-8-6-15(7-9-16)5-3-1-2-4-12-19/h6-9H,1-5,10-14,19H2 |
| InChIKey | FNOIGDUYJDTLEP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|