C16H27Cl2N3 — CID 169043206
N'-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]pentane-1,5-diamine (PubChem CID 169043206) has the molecular formula C16H27Cl2N3 and a molecular weight of 332.32 g/mol. Its IUPAC name is N'-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]pentane-1,5-diamine.
| Compound Name | N'-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 169043206 |
| Molecular Formula | C16H27Cl2N3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N'-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]pentane-1,5-diamine |
| SMILES | NCCCCCNCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C16H27Cl2N3/c17-8-12-21(13-9-18)16-6-4-15(5-7-16)14-20-11-3-1-2-10-19/h4-7,20H,1-3,8-14,19H2 |
| InChIKey | RLLAKABVCGSGME-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|