C11H15BrCl2N2 — CID 170195813
4-[(bromoamino)methyl]-N,N-bis(2-chloroethyl)aniline (PubChem CID 170195813) has the molecular formula C11H15BrCl2N2 and a molecular weight of 326.07 g/mol. Its IUPAC name is 4-[(bromoamino)methyl]-N,N-bis(2-chloroethyl)aniline.
| Compound Name | 4-[(bromoamino)methyl]-N,N-bis(2-chloroethyl)aniline |
|---|---|
| PubChem CID | 170195813 |
| Molecular Formula | C11H15BrCl2N2 |
| Molecular Weight | 326.07 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 4-[(bromoamino)methyl]-N,N-bis(2-chloroethyl)aniline |
| SMILES | ClCCN(CCCl)c1ccc(CNBr)cc1 |
| InChI | InChI=1S/C11H15BrCl2N2/c12-15-9-10-1-3-11(4-2-10)16(7-5-13)8-6-14/h1-4,15H,5-9H2 |
| InChIKey | RETBPCLRSOFCFR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.07 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|