C17H29Cl2N3O — CID 170195234
4-[[2-(4-aminobutan-2-yloxy)ethylamino]methyl]-N,N-bis(2-chloroethyl)aniline (PubChem CID 170195234) has the molecular formula C17H29Cl2N3O and a molecular weight of 362.35 g/mol. Its IUPAC name is 4-[[2-(4-aminobutan-2-yloxy)ethylamino]methyl]-N,N-bis(2-chloroethyl)aniline.
| Compound Name | 4-[[2-(4-aminobutan-2-yloxy)ethylamino]methyl]-N,N-bis(2-chloroethyl)aniline |
|---|---|
| PubChem CID | 170195234 |
| Molecular Formula | C17H29Cl2N3O |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-[[2-(4-aminobutan-2-yloxy)ethylamino]methyl]-N,N-bis(2-chloroethyl)aniline |
| SMILES | CC(CCN)OCCNCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C17H29Cl2N3O/c1-15(6-9-20)23-13-10-21-14-16-2-4-17(5-3-16)22(11-7-18)12-8-19/h2-5,15,21H,6-14,20H2,1H3 |
| InChIKey | GZKSPNVILGJTPM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|