C14H22Cl2N2O2 — CID 145293731
2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanal;methanol (PubChem CID 145293731) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanal;methanol.
| Compound Name | 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanal;methanol |
|---|---|
| PubChem CID | 145293731 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanal;methanol |
| SMILES | CO.NC(C=O)Cc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C13H18Cl2N2O.CH4O/c14-5-7-17(8-6-15)13-3-1-11(2-4-13)9-12(16)10-18;1-2/h1-4,10,12H,5-9,16H2;2H,1H3 |
| InChIKey | JHIOVOOSRUEIGE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|