C19H30Cl2N5O2PS — CID 87120049
(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;tris(aziridin-1-yl)-sulfanylidene-λ5-phosphane (PubChem CID 87120049) has the molecular formula C19H30Cl2N5O2PS and a molecular weight of 494.43 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;tris(aziridin-1-yl)-sulfanylidene-λ5-phosphane.
| Compound Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;tris(aziridin-1-yl)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 87120049 |
| Molecular Formula | C19H30Cl2N5O2PS |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;tris(aziridin-1-yl)-sulfanylidene-λ5-phosphane |
| SMILES | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.S=P(N1CC1)(N1CC1)N1CC1 |
| InChI | InChI=1S/C13H18Cl2N2O2.C6H12N3PS/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19;11-10(7-1-2-7,8-3-4-8)9-5-6-9/h1-4,12H,5-9,16H2,(H,18,19);1-6H2/t12-;/m0./s1 |
| InChIKey | NKZPTVDSEQIOJL-YDALLXLXSA-N |
| XLogP | 2.08 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|