C28H39Cl2N5O4 — CID 67779379
[(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-methylcarbamate;(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid (PubChem CID 67779379) has the molecular formula C28H39Cl2N5O4 and a molecular weight of 580.56 g/mol. Its IUPAC name is [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-methylcarbamate;(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid.
| Compound Name | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-methylcarbamate;(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67779379 |
| Molecular Formula | C28H39Cl2N5O4 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-methylcarbamate;(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid |
| SMILES | CNC(=O)Oc1ccc2c(c1)[C@]1(C)CCN(C)[C@@H]1N2C.N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C15H21N3O2.C13H18Cl2N2O2/c1-15-7-8-17(3)13(15)18(4)12-6-5-10(9-11(12)15)20-14(19)16-2;14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h5-6,9,13H,7-8H2,1-4H3,(H,16,19);1-4,12H,5-9,16H2,(H,18,19)/t13-,15+;12-/m10/s1 |
| InChIKey | FTMXWUUGHJLEMG-HWKCKFCBSA-N |
| XLogP | 3.70 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|