C13H18Cl2N2O2 — CID 4053
2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid (PubChem CID 4053) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 4053 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19) |
| InChIKey | SGDBTWWWUNNDEQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|