C20H33Cl4N4O4P — CID 66698310
(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 66698310) has the molecular formula C20H33Cl4N4O4P and a molecular weight of 566.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 66698310 |
| Molecular Formula | C20H33Cl4N4O4P |
| Molecular Weight | 566.29 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.O=P1(N(CCCl)CCCl)NCCCO1 |
| InChI | InChI=1S/C13H18Cl2N2O2.C7H15Cl2N2O2P/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19;8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-4,12H,5-9,16H2,(H,18,19);1-7H2,(H,10,12)/t12-;/m0./s1 |
| InChIKey | FVZVPCZPKTUFJO-YDALLXLXSA-N |
| XLogP | 3.81 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|