C13H22Cl2N2O2 — CID 18314886
2-amino-3-[4-(diethylamino)phenyl]propanoic acid;dihydrochloride (PubChem CID 18314886) has the molecular formula C13H22Cl2N2O2 and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-amino-3-[4-(diethylamino)phenyl]propanoic acid;dihydrochloride.
| Compound Name | 2-amino-3-[4-(diethylamino)phenyl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 18314886 |
| Molecular Formula | C13H22Cl2N2O2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-amino-3-[4-(diethylamino)phenyl]propanoic acid;dihydrochloride |
| SMILES | CCN(CC)c1ccc(CC(N)C(=O)O)cc1.Cl.Cl |
| InChI | InChI=1S/C13H20N2O2.2ClH/c1-3-15(4-2)11-7-5-10(6-8-11)9-12(14)13(16)17;;/h5-8,12H,3-4,9,14H2,1-2H3,(H,16,17);2*1H |
| InChIKey | FREVDWRBZRDHGR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|