C11H18Cl2N2O2 — CID 22603322
2-amino-3-[4-(ethylamino)phenyl]propanoic acid;dihydrochloride (PubChem CID 22603322) has the molecular formula C11H18Cl2N2O2 and a molecular weight of 281.18 g/mol. Its IUPAC name is 2-amino-3-[4-(ethylamino)phenyl]propanoic acid;dihydrochloride.
| Compound Name | 2-amino-3-[4-(ethylamino)phenyl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 22603322 |
| Molecular Formula | C11H18Cl2N2O2 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-amino-3-[4-(ethylamino)phenyl]propanoic acid;dihydrochloride |
| SMILES | CCNc1ccc(CC(N)C(=O)O)cc1.Cl.Cl |
| InChI | InChI=1S/C11H16N2O2.2ClH/c1-2-13-9-5-3-8(4-6-9)7-10(12)11(14)15;;/h3-6,10,13H,2,7,12H2,1H3,(H,14,15);2*1H |
| InChIKey | IABVOBFYOWBOPI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |