C16H17N3O3 — CID 130323270
(2S)-2-amino-3-[4-(phenylcarbamoylamino)phenyl]propanoic acid (PubChem CID 130323270) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(phenylcarbamoylamino)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(phenylcarbamoylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 130323270 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2S)-2-amino-3-[4-(phenylcarbamoylamino)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(NC(=O)Nc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C16H17N3O3/c17-14(15(20)21)10-11-6-8-13(9-7-11)19-16(22)18-12-4-2-1-3-5-12/h1-9,14H,10,17H2,(H,20,21)(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | ZMMVVAJSVJKCII-AWEZNQCLSA-N |
| XLogP | 2.29 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |