C17H20N6O3 — CID 20666953
2-amino-3-[4-[[3-(diaminomethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid (PubChem CID 20666953) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-amino-3-[4-[[3-(diaminomethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[[3-(diaminomethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20666953 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-amino-3-[4-[[3-(diaminomethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid |
| SMILES | NC(N)=Nc1cccc(NC(=O)Nc2ccc(CC(N)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C17H20N6O3/c18-14(15(24)25)8-10-4-6-11(7-5-10)22-17(26)23-13-3-1-2-12(9-13)21-16(19)20/h1-7,9,14H,8,18H2,(H,24,25)(H4,19,20,21)(H2,22,23,26) |
| InChIKey | ILPZBQGXEHDFFG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|