C19H22N6O4 — CID 21191442
2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid (PubChem CID 21191442) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid.
| Compound Name | 2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 21191442 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)phenyl]carbamoylamino]phenyl]propanoic acid |
| SMILES | CC(=O)NC(Cc1ccc(NC(=O)Nc2cccc(/N=C/NN)c2)cc1)C(=O)O |
| InChI | InChI=1S/C19H22N6O4/c1-12(26)23-17(18(27)28)9-13-5-7-14(8-6-13)24-19(29)25-16-4-2-3-15(10-16)21-11-22-20/h2-8,10-11,17H,9,20H2,1H3,(H,21,22)(H,23,26)(H,27,28)(H2,24,25,29) |
| InChIKey | UTVUPRALEHQTEG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|