C19H21N5O4 — CID 70071604
(2S)-2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid (PubChem CID 70071604) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70071604 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (2S)-2-acetamido-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccc(NC(=O)c2cccc(/N=C/NN)c2)cc1)C(=O)O |
| InChI | InChI=1S/C19H21N5O4/c1-12(25)23-17(19(27)28)9-13-5-7-15(8-6-13)24-18(26)14-3-2-4-16(10-14)21-11-22-20/h2-8,10-11,17H,9,20H2,1H3,(H,21,22)(H,23,25)(H,24,26)(H,27,28)/t17-/m0/s1 |
| InChIKey | KTJCFMAEFZIIRZ-KRWDZBQOSA-N |
| XLogP | 1.19 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|