C23H29N5O4 — CID 70073147
(2S)-2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid (PubChem CID 70073147) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is (2S)-2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70073147 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (2S)-2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]propanoic acid |
| SMILES | CC(C)(C)CC(=O)N[C@@H](Cc1ccc(NC(=O)c2cccc(/N=C/NN)c2)cc1)C(=O)O |
| InChI | InChI=1S/C23H29N5O4/c1-23(2,3)13-20(29)28-19(22(31)32)11-15-7-9-17(10-8-15)27-21(30)16-5-4-6-18(12-16)25-14-26-24/h4-10,12,14,19H,11,13,24H2,1-3H3,(H,25,26)(H,27,30)(H,28,29)(H,31,32)/t19-/m0/s1 |
| InChIKey | ADNCFKDXOJPZQB-IBGZPJMESA-N |
| XLogP | 2.61 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|