C23H28N6O4 — CID 70116249
(2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(piperidine-1-carbonylamino)propanoic acid (PubChem CID 70116249) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(piperidine-1-carbonylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(piperidine-1-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70116249 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (2S)-3-[4-[[3-(hydrazinylmethylideneamino)benzoyl]amino]phenyl]-2-(piperidine-1-carbonylamino)propanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)Nc2ccc(C[C@H](NC(=O)N3CCCCC3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H28N6O4/c24-26-15-25-19-6-4-5-17(14-19)21(30)27-18-9-7-16(8-10-18)13-20(22(31)32)28-23(33)29-11-2-1-3-12-29/h4-10,14-15,20H,1-3,11-13,24H2,(H,25,26)(H,27,30)(H,28,33)(H,31,32)/t20-/m0/s1 |
| InChIKey | XPEVVRQGHLCRKQ-FQEVSTJZSA-N |
| XLogP | 2.25 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|