C18H20N6O4 — CID 22608375
2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 22608375) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 22608375 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)NCC(=O)NC(Cc2cccnc2)C(=O)O)c1 |
| InChI | InChI=1S/C18H20N6O4/c19-23-11-22-14-5-1-4-13(8-14)17(26)21-10-16(25)24-15(18(27)28)7-12-3-2-6-20-9-12/h1-6,8-9,11,15H,7,10,19H2,(H,21,26)(H,22,23)(H,24,25)(H,27,28) |
| InChIKey | QRFAHVXYWWRZSR-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|