C21H25N5O4 — CID 131721660
ethyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate (PubChem CID 131721660) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is ethyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 131721660 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | ethyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cccc(/N=C/NN)c1)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O4/c1-2-30-20(28)12-18(15-7-4-3-5-8-15)26-19(27)13-23-21(29)16-9-6-10-17(11-16)24-14-25-22/h3-11,14,18H,2,12-13,22H2,1H3,(H,23,29)(H,24,25)(H,26,27) |
| InChIKey | IFBHHNVAMUEELB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|