C22H28N6O6S — CID 70059406
methyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 70059406) has the molecular formula C22H28N6O6S and a molecular weight of 504.57 g/mol. Its IUPAC name is methyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | methyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 70059406 |
| Molecular Formula | C22H28N6O6S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | methyl 3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]-2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc(C)cc1)C(C)NC(=O)CNC(=O)c1cccc(/N=C/NN)c1 |
| InChI | InChI=1S/C22H28N6O6S/c1-14-7-9-18(10-8-14)35(32,33)28-20(22(31)34-3)15(2)27-19(29)12-24-21(30)16-5-4-6-17(11-16)25-13-26-23/h4-11,13,15,20,28H,12,23H2,1-3H3,(H,24,30)(H,25,26)(H,27,29) |
| InChIKey | CKTMARRYRLHXHX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 181.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|