C14H15F3N5O4- — CID 154493779
4,4,4-trifluoro-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]butanoate (PubChem CID 154493779) has the molecular formula C14H15F3N5O4- and a molecular weight of 374.30 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]butanoate.
| Compound Name | 4,4,4-trifluoro-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 154493779 |
| Molecular Formula | C14H15F3N5O4- |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 4,4,4-trifluoro-3-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]butanoate |
| SMILES | NN/C=N/c1cccc(C(=O)NCC(=O)NC(CC(=O)[O-])C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3N5O4/c15-14(16,17)10(5-12(24)25)22-11(23)6-19-13(26)8-2-1-3-9(4-8)20-7-21-18/h1-4,7,10H,5-6,18H2,(H,19,26)(H,20,21)(H,22,23)(H,24,25)/p-1 |
| InChIKey | KWIFIAXUSVMKPO-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 148.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|