C23H26Cl2N6O5 — CID 70203017
[2-(dimethylamino)-2-oxoethyl] 3-(3,5-dichlorophenyl)-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoate (PubChem CID 70203017) has the molecular formula C23H26Cl2N6O5 and a molecular weight of 537.40 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 3-(3,5-dichlorophenyl)-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 3-(3,5-dichlorophenyl)-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 70203017 |
| Molecular Formula | C23H26Cl2N6O5 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 3-(3,5-dichlorophenyl)-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]propanoate |
| SMILES | CN(C)C(=O)COC(=O)C(Cc1cc(Cl)cc(Cl)c1)NC(=O)CNC(=O)c1cccc(/N=C/NN)c1 |
| InChI | InChI=1S/C23H26Cl2N6O5/c1-31(2)21(33)12-36-23(35)19(8-14-6-16(24)10-17(25)7-14)30-20(32)11-27-22(34)15-4-3-5-18(9-15)28-13-29-26/h3-7,9-10,13,19H,8,11-12,26H2,1-2H3,(H,27,34)(H,28,29)(H,30,32) |
| InChIKey | JYTYBXRCSZFVGP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 155.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|