C22H28N4O3 — CID 70211012
ethyl 2-[[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]methyl]butanoate (PubChem CID 70211012) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl 2-[[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]methyl]butanoate.
| Compound Name | ethyl 2-[[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 70211012 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | ethyl 2-[[3-[[[3-(hydrazinylmethylideneamino)benzoyl]amino]methyl]phenyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)Cc1cccc(CNC(=O)c2cccc(/N=C/NN)c2)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-3-18(22(28)29-4-2)12-16-7-5-8-17(11-16)14-24-21(27)19-9-6-10-20(13-19)25-15-26-23/h5-11,13,15,18H,3-4,12,14,23H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | CWRJBVKRXVIBDJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|