C28H31NO5 — CID 10874221
ethyl 2-[[4-methoxy-3-[(3-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]butanoate (PubChem CID 10874221) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is ethyl 2-[[4-methoxy-3-[(3-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]butanoate.
| Compound Name | ethyl 2-[[4-methoxy-3-[(3-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 10874221 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | ethyl 2-[[4-methoxy-3-[(3-phenoxyphenyl)methylcarbamoyl]phenyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)Cc1ccc(OC)c(C(=O)NCc2cccc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H31NO5/c1-4-22(28(31)33-5-2)16-20-14-15-26(32-3)25(18-20)27(30)29-19-21-10-9-13-24(17-21)34-23-11-7-6-8-12-23/h6-15,17-18,22H,4-5,16,19H2,1-3H3,(H,29,30) |
| InChIKey | VFNQHEZTQKSKOD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |