C23H26F3NO4 — CID 10972172
ethyl 2-[[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]butanoate (PubChem CID 10972172) has the molecular formula C23H26F3NO4 and a molecular weight of 437.46 g/mol. Its IUPAC name is ethyl 2-[[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]butanoate.
| Compound Name | ethyl 2-[[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 10972172 |
| Molecular Formula | C23H26F3NO4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | ethyl 2-[[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)Cc1ccc(OC)c(C(=O)NCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H26F3NO4/c1-4-17(22(29)31-5-2)11-15-9-10-20(30-3)19(13-15)21(28)27-14-16-7-6-8-18(12-16)23(24,25)26/h6-10,12-13,17H,4-5,11,14H2,1-3H3,(H,27,28) |
| InChIKey | OBRGNMQASRXSIA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |