C19H15F3N2O4S — CID 15426631
5-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 15426631) has the molecular formula C19H15F3N2O4S and a molecular weight of 424.40 g/mol. Its IUPAC name is 5-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 5-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 15426631 |
| Molecular Formula | C19H15F3N2O4S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 5-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | COc1ccc(C2SC(=O)NC2=O)cc1C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O4S/c1-28-14-6-5-11(15-17(26)24-18(27)29-15)8-13(14)16(25)23-9-10-3-2-4-12(7-10)19(20,21)22/h2-8,15H,9H2,1H3,(H,23,25)(H,24,26,27) |
| InChIKey | JHPQHKMGEZDIAY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|