C21H23F3N2O4S — CID 100588557
2-methoxy-5-piperidin-1-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 100588557) has the molecular formula C21H23F3N2O4S and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-methoxy-5-piperidin-1-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 2-methoxy-5-piperidin-1-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 100588557 |
| Molecular Formula | C21H23F3N2O4S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-methoxy-5-piperidin-1-ylsulfonyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23F3N2O4S/c1-30-19-9-8-17(31(28,29)26-10-3-2-4-11-26)13-18(19)20(27)25-14-15-6-5-7-16(12-15)21(22,23)24/h5-9,12-13H,2-4,10-11,14H2,1H3,(H,25,27) |
| InChIKey | CTSCXHFYVVCZAI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |