C20H24N2O4S — CID 28590884
2-methoxy-N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 28590884) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-methoxy-N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-methoxy-N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 28590884 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-methoxy-N-[(2-methylphenyl)methyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1C(=O)NCc1ccccc1C |
| InChI | InChI=1S/C20H24N2O4S/c1-15-7-3-4-8-16(15)14-21-20(23)18-13-17(9-10-19(18)26-2)27(24,25)22-11-5-6-12-22/h3-4,7-10,13H,5-6,11-12,14H2,1-2H3,(H,21,23) |
| InChIKey | BAKJTYDHHYKEOL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |