C20H17F3N2O5S — CID 156614158
5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[[3-hydroxy-4-(trifluoromethyl)phenyl]methyl]-2-methoxybenzamide (PubChem CID 156614158) has the molecular formula C20H17F3N2O5S and a molecular weight of 454.43 g/mol. Its IUPAC name is 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[[3-hydroxy-4-(trifluoromethyl)phenyl]methyl]-2-methoxybenzamide.
| Compound Name | 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[[3-hydroxy-4-(trifluoromethyl)phenyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 156614158 |
| Molecular Formula | C20H17F3N2O5S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-N-[[3-hydroxy-4-(trifluoromethyl)phenyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccc(CC2SC(=O)NC2=O)cc1C(=O)NCc1ccc(C(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C20H17F3N2O5S/c1-30-15-5-3-10(8-16-18(28)25-19(29)31-16)6-12(15)17(27)24-9-11-2-4-13(14(26)7-11)20(21,22)23/h2-7,16,26H,8-9H2,1H3,(H,24,27)(H,25,28,29) |
| InChIKey | VUNZTCGRZFJOHV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|