C20H19F3N2O4S — CID 58596453
5-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 58596453) has the molecular formula C20H19F3N2O4S and a molecular weight of 440.44 g/mol. Its IUPAC name is 5-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58596453 |
| Molecular Formula | C20H19F3N2O4S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 5-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(CC2SC(=O)NC2=O)cc1OCNCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N2O4S/c1-28-15-7-4-13(9-17-18(26)25-19(27)30-17)8-16(15)29-11-24-10-12-2-5-14(6-3-12)20(21,22)23/h2-8,17,24H,9-11H2,1H3,(H,25,26,27) |
| InChIKey | BIPYUNMSCLJOAP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|