C20H16F3NO5S — CID 88928818
[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethyl)phenyl]ethyl] formate (PubChem CID 88928818) has the molecular formula C20H16F3NO5S and a molecular weight of 439.41 g/mol. Its IUPAC name is [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethyl)phenyl]ethyl] formate.
| Compound Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethyl)phenyl]ethyl] formate |
|---|---|
| PubChem CID | 88928818 |
| Molecular Formula | C20H16F3NO5S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-[3-(trifluoromethyl)phenyl]ethyl] formate |
| SMILES | O=COC(COc1ccc(CC2SC(=O)NC2=O)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3NO5S/c21-20(22,23)14-3-1-2-13(9-14)16(29-11-25)10-28-15-6-4-12(5-7-15)8-17-18(26)24-19(27)30-17/h1-7,9,11,16-17H,8,10H2,(H,24,26,27) |
| InChIKey | LCCXDDKTOHAGOO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|