C18H17NO3S — CID 46231546
5-[[4-(2,4-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 46231546) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 5-[[4-(2,4-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(2,4-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46231546 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 5-[[4-(2,4-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H17NO3S/c1-11-3-8-15(12(2)9-11)22-14-6-4-13(5-7-14)10-16-17(20)19-18(21)23-16/h3-9,16H,10H2,1-2H3,(H,19,20,21) |
| InChIKey | ZLIRARCVHMGDHN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|