C21H19F3N2O5S — CID 20777453
N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]methyl]-2-methoxy-4-(trifluoromethyl)benzamide (PubChem CID 20777453) has the molecular formula C21H19F3N2O5S and a molecular weight of 468.45 g/mol. Its IUPAC name is N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]methyl]-2-methoxy-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]methyl]-2-methoxy-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 20777453 |
| Molecular Formula | C21H19F3N2O5S |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-[[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]methyl]-2-methoxy-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(CC2SC(=O)NC2=O)cc1CNC(=O)c1ccc(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C21H19F3N2O5S/c1-30-15-6-3-11(8-17-19(28)26-20(29)32-17)7-12(15)10-25-18(27)14-5-4-13(21(22,23)24)9-16(14)31-2/h3-7,9,17H,8,10H2,1-2H3,(H,25,27)(H,26,28,29) |
| InChIKey | UPDJSYINLPKBMX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|