C20H17ClN2O5S — CID 22418133
5-chloro-N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-2-oxoethyl]-2-methoxybenzamide (PubChem CID 22418133) has the molecular formula C20H17ClN2O5S and a molecular weight of 432.89 g/mol. Its IUPAC name is 5-chloro-N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-2-oxoethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-2-oxoethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 22418133 |
| Molecular Formula | C20H17ClN2O5S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 5-chloro-N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-2-oxoethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCC(=O)c1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C20H17ClN2O5S/c1-28-16-7-6-13(21)9-14(16)18(25)22-10-15(24)12-4-2-11(3-5-12)8-17-19(26)23-20(27)29-17/h2-7,9,17H,8,10H2,1H3,(H,22,25)(H,23,26,27) |
| InChIKey | BETCNFYFMPPXPI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|