C19H16Cl2N2O4S — CID 20777438
N-(2,4-dichlorophenyl)-2-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]acetamide (PubChem CID 20777438) has the molecular formula C19H16Cl2N2O4S and a molecular weight of 439.32 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 20777438 |
| Molecular Formula | C19H16Cl2N2O4S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(CC2SC(=O)NC2=O)cc1CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O4S/c1-27-15-5-2-10(7-16-18(25)23-19(26)28-16)6-11(15)8-17(24)22-14-4-3-12(20)9-13(14)21/h2-6,9,16H,7-8H2,1H3,(H,22,24)(H,23,25,26) |
| InChIKey | JDCXCVJDIBWZQI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|