C18H15ClN2O3S — CID 139774309
2-(3-chlorophenyl)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]acetamide (PubChem CID 139774309) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139774309 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]acetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)Nc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H15ClN2O3S/c19-13-3-1-2-12(8-13)10-16(22)20-14-6-4-11(5-7-14)9-15-17(23)21-18(24)25-15/h1-8,15H,9-10H2,(H,20,22)(H,21,23,24) |
| InChIKey | IKQVTIPWROPLHJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|