C18H15FN2O4S — CID 10571429
N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 10571429) has the molecular formula C18H15FN2O4S and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 10571429 |
| Molecular Formula | C18H15FN2O4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1cc(CC2SC(=O)NC2=O)ccc1O |
| InChI | InChI=1S/C18H15FN2O4S/c19-12-4-1-10(2-5-12)9-16(23)20-13-7-11(3-6-14(13)22)8-15-17(24)21-18(25)26-15/h1-7,15,22H,8-9H2,(H,20,23)(H,21,24,25) |
| InChIKey | SRVXLSXOTBKGGG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|