C14H11Cl2NO2 — CID 1262869
N-(5-chloro-2-hydroxyphenyl)-2-(4-chlorophenyl)acetamide (PubChem CID 1262869) has the molecular formula C14H11Cl2NO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 1262869 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H11Cl2NO2/c15-10-3-1-9(2-4-10)7-14(19)17-12-8-11(16)5-6-13(12)18/h1-6,8,18H,7H2,(H,17,19) |
| InChIKey | PAYUQXMGTXCRLF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|