C17H15Cl2NO4 — CID 66759860
5-(5-chloro-2-hydroxyanilino)-3-(4-chlorophenyl)-5-oxopentanoic acid (PubChem CID 66759860) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is 5-(5-chloro-2-hydroxyanilino)-3-(4-chlorophenyl)-5-oxopentanoic acid.
| Compound Name | 5-(5-chloro-2-hydroxyanilino)-3-(4-chlorophenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 66759860 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 5-(5-chloro-2-hydroxyanilino)-3-(4-chlorophenyl)-5-oxopentanoic acid |
| SMILES | O=C(O)CC(CC(=O)Nc1cc(Cl)ccc1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO4/c18-12-3-1-10(2-4-12)11(8-17(23)24)7-16(22)20-14-9-13(19)5-6-15(14)21/h1-6,9,11,21H,7-8H2,(H,20,22)(H,23,24) |
| InChIKey | OJQWAJHJNJANPC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|