C24H22ClNO4 — CID 76901440
5-[4-(4-chlorophenoxy)anilino]-3-(4-methylphenyl)-5-oxopentanoic acid (PubChem CID 76901440) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is 5-[4-(4-chlorophenoxy)anilino]-3-(4-methylphenyl)-5-oxopentanoic acid.
| Compound Name | 5-[4-(4-chlorophenoxy)anilino]-3-(4-methylphenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 76901440 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 5-[4-(4-chlorophenoxy)anilino]-3-(4-methylphenyl)-5-oxopentanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)CC(=O)Nc2ccc(Oc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H22ClNO4/c1-16-2-4-17(5-3-16)18(15-24(28)29)14-23(27)26-20-8-12-22(13-9-20)30-21-10-6-19(25)7-11-21/h2-13,18H,14-15H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | WOTDIFKPTDYJBL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |