C17H17ClN2O4 — CID 41397676
(2S)-2-(benzylamino)-4-(5-chloro-2-hydroxyanilino)-4-oxobutanoic acid (PubChem CID 41397676) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is (2S)-2-(benzylamino)-4-(5-chloro-2-hydroxyanilino)-4-oxobutanoic acid.
| Compound Name | (2S)-2-(benzylamino)-4-(5-chloro-2-hydroxyanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 41397676 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2S)-2-(benzylamino)-4-(5-chloro-2-hydroxyanilino)-4-oxobutanoic acid |
| SMILES | O=C(C[C@H](NCc1ccccc1)C(=O)O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H17ClN2O4/c18-12-6-7-15(21)13(8-12)20-16(22)9-14(17(23)24)19-10-11-4-2-1-3-5-11/h1-8,14,19,21H,9-10H2,(H,20,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | JYFIXBXWPITOMO-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|