C21H20N2O3 — CID 7592793
(2R)-2-(benzylamino)-4-(naphthalen-2-ylamino)-4-oxobutanoic acid (PubChem CID 7592793) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R)-2-(benzylamino)-4-(naphthalen-2-ylamino)-4-oxobutanoic acid.
| Compound Name | (2R)-2-(benzylamino)-4-(naphthalen-2-ylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7592793 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2R)-2-(benzylamino)-4-(naphthalen-2-ylamino)-4-oxobutanoic acid |
| SMILES | O=C(C[C@@H](NCc1ccccc1)C(=O)O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H20N2O3/c24-20(23-18-11-10-16-8-4-5-9-17(16)12-18)13-19(21(25)26)22-14-15-6-2-1-3-7-15/h1-12,19,22H,13-14H2,(H,23,24)(H,25,26)/t19-/m1/s1 |
| InChIKey | NNRFYTFSQKFQGZ-LJQANCHMSA-N |
| XLogP | 3.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |