C18H18N2O5 — CID 35526882
(2S)-4-(1,3-benzodioxol-5-ylamino)-2-(benzylamino)-4-oxobutanoic acid (PubChem CID 35526882) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is (2S)-4-(1,3-benzodioxol-5-ylamino)-2-(benzylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-(1,3-benzodioxol-5-ylamino)-2-(benzylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 35526882 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (2S)-4-(1,3-benzodioxol-5-ylamino)-2-(benzylamino)-4-oxobutanoic acid |
| SMILES | O=C(C[C@H](NCc1ccccc1)C(=O)O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18N2O5/c21-17(20-13-6-7-15-16(8-13)25-11-24-15)9-14(18(22)23)19-10-12-4-2-1-3-5-12/h1-8,14,19H,9-11H2,(H,20,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | GQHAGGKDHWYAEO-AWEZNQCLSA-N |
| XLogP | 1.99 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |