C17H17NO5S — CID 2226482
N-(1,3-benzodioxol-5-yl)-3-benzylsulfonylpropanamide (PubChem CID 2226482) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-benzylsulfonylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-benzylsulfonylpropanamide |
|---|---|
| PubChem CID | 2226482 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-benzylsulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO5S/c19-17(18-14-6-7-15-16(10-14)23-12-22-15)8-9-24(20,21)11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,18,19) |
| InChIKey | DGVPGHRQVFIIRS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |