C15H14N2O3 — CID 110468454
N-(1,3-benzodioxol-5-yl)-3-pyridin-4-ylpropanamide (PubChem CID 110468454) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-pyridin-4-ylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 110468454 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-pyridin-4-ylpropanamide |
| SMILES | O=C(CCc1ccncc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14N2O3/c18-15(4-1-11-5-7-16-8-6-11)17-12-2-3-13-14(9-12)20-10-19-13/h2-3,5-9H,1,4,10H2,(H,17,18) |
| InChIKey | ZHUMKWLZUJFCKT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |