C14H13N3O4S — CID 23818664
N-(1,3-benzodioxol-5-yl)-N'-(1,3-thiazol-2-yl)butanediamide (PubChem CID 23818664) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 23818664 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(1,3-thiazol-2-yl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1nccs1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13N3O4S/c18-12(3-4-13(19)17-14-15-5-6-22-14)16-9-1-2-10-11(7-9)21-8-20-10/h1-2,5-7H,3-4,8H2,(H,16,18)(H,15,17,19) |
| InChIKey | DHPNQMCHDSDSEH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |