C13H11N3O4S2 — CID 167963546
N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide (PubChem CID 167963546) has the molecular formula C13H11N3O4S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 167963546 |
| Molecular Formula | C13H11N3O4S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nccs1)NC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H11N3O4S2/c17-11(6-22-13-14-3-4-21-13)16-12(18)15-8-1-2-9-10(5-8)20-7-19-9/h1-5H,6-7H2,(H2,15,16,17,18) |
| InChIKey | PFVCXYJHSWUOMG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|