C15H15N5O4S2 — CID 46641902
N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 46641902) has the molecular formula C15H15N5O4S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 46641902 |
| Molecular Formula | C15H15N5O4S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)NC(=O)Nc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C15H15N5O4S2/c1-2-5-16-14-19-20-15(26-14)25-7-12(21)18-13(22)17-9-3-4-10-11(6-9)24-8-23-10/h2-4,6H,1,5,7-8H2,(H,16,19)(H2,17,18,21,22) |
| InChIKey | ONQNNKQHTKMOEH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|