C15H15N5OS2 — CID 8956965
N-[4-(cyanomethyl)phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 8956965) has the molecular formula C15H15N5OS2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 8956965 |
| Molecular Formula | C15H15N5OS2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)Nc2ccc(CC#N)cc2)s1 |
| InChI | InChI=1S/C15H15N5OS2/c1-2-9-17-14-19-20-15(23-14)22-10-13(21)18-12-5-3-11(4-6-12)7-8-16/h2-6H,1,7,9-10H2,(H,17,19)(H,18,21) |
| InChIKey | KTTHDMMZLWOQBX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|